About [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate
[(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate (PubChem CID 70857426) has the molecular formula C27H30O2
and a molecular weight of 386.54 g/mol. Its IUPAC name is [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate.
Molecular Properties
| Compound Name | [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate |
| PubChem CID | 70857426 |
| Molecular Formula | C27H30O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)O[C@H](CC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H30O2/c1-3-5-7-10-21-13-15-22(16-14-21)23-17-19-25(20-18-23)27(28)29-26(4-2)24-11-8-6-9-12-24/h6,8-9,11-20,26H,3-5,7,10H2,1-2H3/t26-/m1/s1 |
| InChIKey | ZNLGWMIACVJVBD-AREMUKBSSA-N |
| XLogP | 7.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate?
The IUPAC name of [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate (CID 70857426) is [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate.
What is the SMILES notation for [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate?
The canonical SMILES for [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate is CCCCCc1ccc(-c2ccc(C(=O)O[C@H](CC)c3ccccc3)cc2)cc1.
What is the InChIKey of [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate?
The InChIKey is ZNLGWMIACVJVBD-AREMUKBSSA-N. The full InChI is InChI=1S/C27H30O2/c1-3-5-7-10-21-13-15-22(16-14-21)23-17-19-25(20-18-23)27(28)29-26(4-2)24-11-8-6-9-12-24/h6,8-9,11-20,26H,3-5,7,10H2,1-2H3/t26-/m1/s1.
What are the key properties of [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate?
[(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate has a molecular weight of 386.54 g/mol, XLogP of 7.39, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-phenylpropyl] 4-(4-pentylphenyl)benzoate is sourced from PubChem (CID 70857426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).