About 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate
1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate (PubChem CID 54438847) has the molecular formula C31H47NO3
and a molecular weight of 481.72 g/mol. Its IUPAC name is 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate.
Molecular Properties
| Compound Name | 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate |
| PubChem CID | 54438847 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate |
| SMILES | CCCCCCCCCCc1ccc(C(CC)OC(=O)c2ccc(OCCCCCC)nc2)cc1 |
| InChI | InChI=1S/C31H47NO3/c1-4-7-9-11-12-13-14-15-17-26-18-20-27(21-19-26)29(6-3)35-31(33)28-22-23-30(32-25-28)34-24-16-10-8-5-2/h18-23,25,29H,4-17,24H2,1-3H3 |
| InChIKey | WMQPJPRERBIHLJ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate?
The IUPAC name of 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate (CID 54438847) is 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate.
What is the SMILES notation for 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate?
The canonical SMILES for 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate is CCCCCCCCCCc1ccc(C(CC)OC(=O)c2ccc(OCCCCCC)nc2)cc1.
What is the InChIKey of 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate?
The InChIKey is WMQPJPRERBIHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H47NO3/c1-4-7-9-11-12-13-14-15-17-26-18-20-27(21-19-26)29(6-3)35-31(33)28-22-23-30(32-25-28)34-24-16-10-8-5-2/h18-23,25,29H,4-17,24H2,1-3H3.
What are the key properties of 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate?
1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate has a molecular weight of 481.72 g/mol, XLogP of 9.03, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-decylphenyl)propyl 6-hexoxypyridine-3-carboxylate is sourced from PubChem (CID 54438847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).