About 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate
1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate (PubChem CID 54110715) has the molecular formula C32H54O3
and a molecular weight of 486.78 g/mol. Its IUPAC name is 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate |
| PubChem CID | 54110715 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate |
| SMILES | CCCCCCCCOC1CCC(C(=O)OC(CC)c2ccc(CCCCCCCC)cc2)CC1 |
| InChI | InChI=1S/C32H54O3/c1-4-7-9-11-13-15-17-27-18-20-28(21-19-27)31(6-3)35-32(33)29-22-24-30(25-23-29)34-26-16-14-12-10-8-5-2/h18-21,29-31H,4-17,22-26H2,1-3H3 |
| InChIKey | NGWXEDJLBNAVIU-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate?
The IUPAC name of 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate (CID 54110715) is 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate.
What is the SMILES notation for 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate?
The canonical SMILES for 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate is CCCCCCCCOC1CCC(C(=O)OC(CC)c2ccc(CCCCCCCC)cc2)CC1.
What is the InChIKey of 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate?
The InChIKey is NGWXEDJLBNAVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H54O3/c1-4-7-9-11-13-15-17-27-18-20-28(21-19-27)31(6-3)35-32(33)29-22-24-30(25-23-29)34-26-16-14-12-10-8-5-2/h18-21,29-31H,4-17,22-26H2,1-3H3.
What are the key properties of 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate?
1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate has a molecular weight of 486.78 g/mol, XLogP of 9.52, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-octylphenyl)propyl 4-octoxycyclohexane-1-carboxylate is sourced from PubChem (CID 54110715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).