About 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate
1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate (PubChem CID 54146952) has the molecular formula C32H50N2O2
and a molecular weight of 494.76 g/mol. Its IUPAC name is 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate |
| PubChem CID | 54146952 |
| Molecular Formula | C32H50N2O2 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate |
| SMILES | CCCCCCCCCc1ccc(C(CC)OC(=O)c2ncc(CCCCCCCCC)cn2)cc1 |
| InChI | InChI=1S/C32H50N2O2/c1-4-7-9-11-13-15-17-19-27-21-23-29(24-22-27)30(6-3)36-32(35)31-33-25-28(26-34-31)20-18-16-14-12-10-8-5-2/h21-26,30H,4-20H2,1-3H3 |
| InChIKey | OFAWYKIVOBYLCV-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate?
The IUPAC name of 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate (CID 54146952) is 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate.
What is the SMILES notation for 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate?
The canonical SMILES for 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate is CCCCCCCCCc1ccc(C(CC)OC(=O)c2ncc(CCCCCCCCC)cn2)cc1.
What is the InChIKey of 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate?
The InChIKey is OFAWYKIVOBYLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H50N2O2/c1-4-7-9-11-13-15-17-19-27-21-23-29(24-22-27)30(6-3)36-32(35)31-33-25-28(26-34-31)20-18-16-14-12-10-8-5-2/h21-26,30H,4-20H2,1-3H3.
What are the key properties of 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate?
1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate has a molecular weight of 494.76 g/mol, XLogP of 9.37, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-nonylphenyl)propyl 5-nonylpyrimidine-2-carboxylate is sourced from PubChem (CID 54146952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).