C28H40F2N2O3 — CID 139775927
(4-decoxy-2,3-difluorophenyl) 5-heptylpyrimidine-2-carboxylate (PubChem CID 139775927) has the molecular formula C28H40F2N2O3 and a molecular weight of 490.64 g/mol. Its IUPAC name is (4-decoxy-2,3-difluorophenyl) 5-heptylpyrimidine-2-carboxylate.
| Compound Name | (4-decoxy-2,3-difluorophenyl) 5-heptylpyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 139775927 |
| Molecular Formula | C28H40F2N2O3 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | (4-decoxy-2,3-difluorophenyl) 5-heptylpyrimidine-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)c2ncc(CCCCCCC)cn2)c(F)c1F |
| InChI | InChI=1S/C28H40F2N2O3/c1-3-5-7-9-10-11-13-15-19-34-23-17-18-24(26(30)25(23)29)35-28(33)27-31-20-22(21-32-27)16-14-12-8-6-4-2/h17-18,20-21H,3-16,19H2,1-2H3 |
| InChIKey | NVGUKXXGBIVHJR-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|