C30H38F2N2O3 — CID 22134230
[4-(5-decylpyrimidin-2-yl)-2,3-difluorophenyl] 5-pentylfuran-2-carboxylate (PubChem CID 22134230) has the molecular formula C30H38F2N2O3 and a molecular weight of 512.64 g/mol. Its IUPAC name is [4-(5-decylpyrimidin-2-yl)-2,3-difluorophenyl] 5-pentylfuran-2-carboxylate.
| Compound Name | [4-(5-decylpyrimidin-2-yl)-2,3-difluorophenyl] 5-pentylfuran-2-carboxylate |
|---|---|
| PubChem CID | 22134230 |
| Molecular Formula | C30H38F2N2O3 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | [4-(5-decylpyrimidin-2-yl)-2,3-difluorophenyl] 5-pentylfuran-2-carboxylate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(CCCCC)o3)c(F)c2F)nc1 |
| InChI | InChI=1S/C30H38F2N2O3/c1-3-5-7-8-9-10-11-13-14-22-20-33-29(34-21-22)24-17-19-25(28(32)27(24)31)37-30(35)26-18-16-23(36-26)15-12-6-4-2/h16-21H,3-15H2,1-2H3 |
| InChIKey | IUFSMKZXFSSULR-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|