About 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate
1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate (PubChem CID 54061012) has the molecular formula C24H29NO2
and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate.
Molecular Properties
| Compound Name | 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate |
| PubChem CID | 54061012 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)OC(CC)c2ccc(CC)cc2)c(C#N)c1 |
| InChI | InChI=1S/C24H29NO2/c1-4-7-8-9-19-12-15-22(21(16-19)17-25)24(26)27-23(6-3)20-13-10-18(5-2)11-14-20/h10-16,23H,4-9H2,1-3H3 |
| InChIKey | LZRXSDOAUWPWCK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate?
The IUPAC name of 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate (CID 54061012) is 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate.
What is the SMILES notation for 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate?
The canonical SMILES for 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate is CCCCCc1ccc(C(=O)OC(CC)c2ccc(CC)cc2)c(C#N)c1.
What is the InChIKey of 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate?
The InChIKey is LZRXSDOAUWPWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO2/c1-4-7-8-9-19-12-15-22(21(16-19)17-25)24(26)27-23(6-3)20-13-10-18(5-2)11-14-20/h10-16,23H,4-9H2,1-3H3.
What are the key properties of 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate?
1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate has a molecular weight of 363.50 g/mol, XLogP of 6.16, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylphenyl)propyl 2-cyano-4-pentylbenzoate is sourced from PubChem (CID 54061012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).