About 1-(4-cyanophenyl)propyl 4-pentoxybenzoate
1-(4-cyanophenyl)propyl 4-pentoxybenzoate (PubChem CID 54375399) has the molecular formula C22H25NO3
and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(4-cyanophenyl)propyl 4-pentoxybenzoate.
Molecular Properties
| Compound Name | 1-(4-cyanophenyl)propyl 4-pentoxybenzoate |
| PubChem CID | 54375399 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(4-cyanophenyl)propyl 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)OC(CC)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-3-5-6-15-25-20-13-11-19(12-14-20)22(24)26-21(4-2)18-9-7-17(16-23)8-10-18/h7-14,21H,3-6,15H2,1-2H3 |
| InChIKey | UWDDYLHZHOZSIL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-cyanophenyl)propyl 4-pentoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyanophenyl)propyl 4-pentoxybenzoate?
The IUPAC name of 1-(4-cyanophenyl)propyl 4-pentoxybenzoate (CID 54375399) is 1-(4-cyanophenyl)propyl 4-pentoxybenzoate.
What is the SMILES notation for 1-(4-cyanophenyl)propyl 4-pentoxybenzoate?
The canonical SMILES for 1-(4-cyanophenyl)propyl 4-pentoxybenzoate is CCCCCOc1ccc(C(=O)OC(CC)c2ccc(C#N)cc2)cc1.
What is the InChIKey of 1-(4-cyanophenyl)propyl 4-pentoxybenzoate?
The InChIKey is UWDDYLHZHOZSIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO3/c1-3-5-6-15-25-20-13-11-19(12-14-20)22(24)26-21(4-2)18-9-7-17(16-23)8-10-18/h7-14,21H,3-6,15H2,1-2H3.
What are the key properties of 1-(4-cyanophenyl)propyl 4-pentoxybenzoate?
1-(4-cyanophenyl)propyl 4-pentoxybenzoate has a molecular weight of 351.45 g/mol, XLogP of 5.44, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyanophenyl)propyl 4-pentoxybenzoate is sourced from PubChem (CID 54375399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).