C22H29NO — CID 4027314
4-heptyl-N-(1-phenylethyl)benzamide (PubChem CID 4027314) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-heptyl-N-(1-phenylethyl)benzamide.
| Compound Name | 4-heptyl-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4027314 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 4-heptyl-N-(1-phenylethyl)benzamide |
| SMILES | CCCCCCCc1ccc(C(=O)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H29NO/c1-3-4-5-6-8-11-19-14-16-21(17-15-19)22(24)23-18(2)20-12-9-7-10-13-20/h7,9-10,12-18H,3-6,8,11H2,1-2H3,(H,23,24) |
| InChIKey | FUVRDHCYYNDSRT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|