About [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate
[4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate (PubChem CID 23597756) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate.
Molecular Properties
| Compound Name | [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate |
| PubChem CID | 23597756 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2ccc(C(=O)NC(C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-3-18-9-11-21(12-10-18)24(27)28-22-15-13-20(14-16-22)23(26)25-17(2)19-7-5-4-6-8-19/h4-17H,3H2,1-2H3,(H,25,26) |
| InChIKey | WBUQPULWUVGZMG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate?
The IUPAC name of [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate (CID 23597756) is [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate.
What is the SMILES notation for [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate?
The canonical SMILES for [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate is CCc1ccc(C(=O)Oc2ccc(C(=O)NC(C)c3ccccc3)cc2)cc1.
What is the InChIKey of [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate?
The InChIKey is WBUQPULWUVGZMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3/c1-3-18-9-11-21(12-10-18)24(27)28-22-15-13-20(14-16-22)23(26)25-17(2)19-7-5-4-6-8-19/h4-17H,3H2,1-2H3,(H,25,26).
What are the key properties of [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate?
[4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate has a molecular weight of 373.45 g/mol, XLogP of 4.96, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-phenylethylcarbamoyl)phenyl] 4-ethylbenzoate is sourced from PubChem (CID 23597756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).