C31H37NO4 — CID 67485040
3-[[4-[4-[4-(4-pentylphenyl)phenoxy]butyl]benzoyl]amino]propanoic acid (PubChem CID 67485040) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is 3-[[4-[4-[4-(4-pentylphenyl)phenoxy]butyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[4-[4-(4-pentylphenyl)phenoxy]butyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67485040 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 3-[[4-[4-[4-(4-pentylphenyl)phenoxy]butyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCc1ccc(-c2ccc(OCCCCc3ccc(C(=O)NCCC(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H37NO4/c1-2-3-4-7-24-9-13-26(14-10-24)27-17-19-29(20-18-27)36-23-6-5-8-25-11-15-28(16-12-25)31(35)32-22-21-30(33)34/h9-20H,2-8,21-23H2,1H3,(H,32,35)(H,33,34) |
| InChIKey | AWGYZBYRDKKRRU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|