C29H41NO5 — CID 67485973
3-[[4-[7-[4-(4-methylpentoxy)phenoxy]heptyl]benzoyl]amino]propanoic acid (PubChem CID 67485973) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is 3-[[4-[7-[4-(4-methylpentoxy)phenoxy]heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[7-[4-(4-methylpentoxy)phenoxy]heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67485973 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 3-[[4-[7-[4-(4-methylpentoxy)phenoxy]heptyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)CCCOc1ccc(OCCCCCCCc2ccc(C(=O)NCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H41NO5/c1-23(2)9-8-22-35-27-17-15-26(16-18-27)34-21-7-5-3-4-6-10-24-11-13-25(14-12-24)29(33)30-20-19-28(31)32/h11-18,23H,3-10,19-22H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | ZYDXBDXWLSKTOO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|