C28H39NO4 — CID 67486020
3-[[4-[7-(4-pentylphenoxy)heptyl]benzoyl]amino]propanoic acid (PubChem CID 67486020) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is 3-[[4-[7-(4-pentylphenoxy)heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[7-(4-pentylphenoxy)heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67486020 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 3-[[4-[7-(4-pentylphenoxy)heptyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCCc1ccc(OCCCCCCCc2ccc(C(=O)NCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H39NO4/c1-2-3-7-10-24-14-18-26(19-15-24)33-22-9-6-4-5-8-11-23-12-16-25(17-13-23)28(32)29-21-20-27(30)31/h12-19H,2-11,20-22H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | QZUHCWBKNXWACG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|