C30H35NO5 — CID 67485483
methyl 3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoate (PubChem CID 67485483) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is methyl 3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 67485483 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | methyl 3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(CCCCCCOc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H35NO5/c1-34-29(32)20-21-31-30(33)26-14-12-24(13-15-26)9-5-2-3-8-22-35-27-16-18-28(19-17-27)36-23-25-10-6-4-7-11-25/h4,6-7,10-19H,2-3,5,8-9,20-23H2,1H3,(H,31,33) |
| InChIKey | KPSYOEYMBTWLPM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|