C31H41N2O2+ — CID 139793402
benzyl-dimethyl-[4-[[4-(5-phenylpentoxy)benzoyl]amino]butyl]azanium (PubChem CID 139793402) has the molecular formula C31H41N2O2+ and a molecular weight of 473.68 g/mol. Its IUPAC name is benzyl-dimethyl-[4-[[4-(5-phenylpentoxy)benzoyl]amino]butyl]azanium.
| Compound Name | benzyl-dimethyl-[4-[[4-(5-phenylpentoxy)benzoyl]amino]butyl]azanium |
|---|---|
| PubChem CID | 139793402 |
| Molecular Formula | C31H41N2O2+ |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.32 |
| IUPAC Name | benzyl-dimethyl-[4-[[4-(5-phenylpentoxy)benzoyl]amino]butyl]azanium |
| SMILES | C[N+](C)(CCCCNC(=O)c1ccc(OCCCCCc2ccccc2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H40N2O2/c1-33(2,26-28-17-8-4-9-18-28)24-12-11-23-32-31(34)29-19-21-30(22-20-29)35-25-13-5-10-16-27-14-6-3-7-15-27/h3-4,6-9,14-15,17-22H,5,10-13,16,23-26H2,1-2H3/p+1 |
| InChIKey | ODANYOFBKWTNIN-UHFFFAOYSA-O |
| XLogP | 6.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|