C25H27NO3S — CID 43909022
N-[3-(4-methoxyphenyl)propyl]-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 43909022) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)propyl]-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-[3-(4-methoxyphenyl)propyl]-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 43909022 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[3-(4-methoxyphenyl)propyl]-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | COc1ccc(CCCNC(=O)c2ccc(OCCSc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H27NO3S/c1-28-22-13-9-20(10-14-22)6-5-17-26-25(27)21-11-15-23(16-12-21)29-18-19-30-24-7-3-2-4-8-24/h2-4,7-16H,5-6,17-19H2,1H3,(H,26,27) |
| InChIKey | SPBYLIZOOZXESN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|