C23H27NO2S — CID 99951861
N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 99951861) has the molecular formula C23H27NO2S and a molecular weight of 381.54 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 99951861 |
| Molecular Formula | C23H27NO2S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(OCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO2S/c25-23(24-16-15-19-7-3-1-4-8-19)20-11-13-21(14-12-20)26-17-18-27-22-9-5-2-6-10-22/h2,5-7,9-14H,1,3-4,8,15-18H2,(H,24,25) |
| InChIKey | RNMQVRBGFTZUSS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|