C19H29IN4O — CID 111208397
N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111208397) has the molecular formula C19H29IN4O and a molecular weight of 456.37 g/mol. Its IUPAC name is N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111208397 |
| Molecular Formula | C19H29IN4O |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccccc1)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C19H28N4O.HI/c1-20-19(22-13-12-16-8-4-2-5-9-16)23-15-14-21-18(24)17-10-6-3-7-11-17;/h3,6-8,10-11H,2,4-5,9,12-15H2,1H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | SUZDXQPKZLPYOM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|