C20H30IN3O2 — CID 111209012
methyl 4-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzoate;hydroiodide (PubChem CID 111209012) has the molecular formula C20H30IN3O2 and a molecular weight of 471.38 g/mol. Its IUPAC name is methyl 4-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111209012 |
| Molecular Formula | C20H30IN3O2 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | methyl 4-[2-[[N-[2-(cyclohexen-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]benzoate;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCCCC1)NCCc1ccc(C(=O)OC)cc1.I |
| InChI | InChI=1S/C20H29N3O2.HI/c1-21-20(22-14-12-16-6-4-3-5-7-16)23-15-13-17-8-10-18(11-9-17)19(24)25-2;/h6,8-11H,3-5,7,12-15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | DKLMVLTZKMBZJC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|