C25H31N2O2+ — CID 139793428
trimethyl-[2-[[6-(3-phenylpropoxy)naphthalene-2-carbonyl]amino]ethyl]azanium (PubChem CID 139793428) has the molecular formula C25H31N2O2+ and a molecular weight of 391.54 g/mol. Its IUPAC name is trimethyl-[2-[[6-(3-phenylpropoxy)naphthalene-2-carbonyl]amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[6-(3-phenylpropoxy)naphthalene-2-carbonyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 139793428 |
| Molecular Formula | C25H31N2O2+ |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | trimethyl-[2-[[6-(3-phenylpropoxy)naphthalene-2-carbonyl]amino]ethyl]azanium |
| SMILES | C[N+](C)(C)CCNC(=O)c1ccc2cc(OCCCc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C25H30N2O2/c1-27(2,3)16-15-26-25(28)23-12-11-22-19-24(14-13-21(22)18-23)29-17-7-10-20-8-5-4-6-9-20/h4-6,8-9,11-14,18-19H,7,10,15-17H2,1-3H3/p+1 |
| InChIKey | IQVBQLNSZNTPGE-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|