C29H35ClN3O4+ — CID 139793431
(4-chlorophenyl)methyl-dimethyl-[2-[[3-nitro-4-(5-phenylpentoxy)benzoyl]amino]ethyl]azanium (PubChem CID 139793431) has the molecular formula C29H35ClN3O4+ and a molecular weight of 525.07 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-dimethyl-[2-[[3-nitro-4-(5-phenylpentoxy)benzoyl]amino]ethyl]azanium.
| Compound Name | (4-chlorophenyl)methyl-dimethyl-[2-[[3-nitro-4-(5-phenylpentoxy)benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 139793431 |
| Molecular Formula | C29H35ClN3O4+ |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (4-chlorophenyl)methyl-dimethyl-[2-[[3-nitro-4-(5-phenylpentoxy)benzoyl]amino]ethyl]azanium |
| SMILES | C[N+](C)(CCNC(=O)c1ccc(OCCCCCc2ccccc2)c([N+](=O)[O-])c1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H34ClN3O4/c1-33(2,22-24-12-15-26(30)16-13-24)19-18-31-29(34)25-14-17-28(27(21-25)32(35)36)37-20-8-4-7-11-23-9-5-3-6-10-23/h3,5-6,9-10,12-17,21H,4,7-8,11,18-20,22H2,1-2H3/p+1 |
| InChIKey | HJGJWTBEEOYRER-UHFFFAOYSA-O |
| XLogP | 6.05 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|