C15H19NO6 — CID 162957734
(2S)-4-[4-(2-carboxyethylcarbamoyl)phenoxy]-2-methylbutanoic acid (PubChem CID 162957734) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2S)-4-[4-(2-carboxyethylcarbamoyl)phenoxy]-2-methylbutanoic acid.
| Compound Name | (2S)-4-[4-(2-carboxyethylcarbamoyl)phenoxy]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 162957734 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2S)-4-[4-(2-carboxyethylcarbamoyl)phenoxy]-2-methylbutanoic acid |
| SMILES | C[C@@H](CCOc1ccc(C(=O)NCCC(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C15H19NO6/c1-10(15(20)21)7-9-22-12-4-2-11(3-5-12)14(19)16-8-6-13(17)18/h2-5,10H,6-9H2,1H3,(H,16,19)(H,17,18)(H,20,21)/t10-/m0/s1 |
| InChIKey | AQYVBRADYQRCEE-JTQLQIEISA-N |
| XLogP | 1.38 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |