C26H33NO2 — CID 143792921
N-[(3-butoxyphenyl)methyl]-4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzamide (PubChem CID 143792921) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-[(3-butoxyphenyl)methyl]-4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzamide.
| Compound Name | N-[(3-butoxyphenyl)methyl]-4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzamide |
|---|---|
| PubChem CID | 143792921 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | N-[(3-butoxyphenyl)methyl]-4-methyl-3-[(1Z,3E)-4-methylhexa-1,3-dienyl]benzamide |
| SMILES | CCCCOc1cccc(CNC(=O)c2ccc(C)c(/C=C\C=C(/C)CC)c2)c1 |
| InChI | InChI=1S/C26H33NO2/c1-5-7-16-29-25-13-9-11-22(17-25)19-27-26(28)24-15-14-21(4)23(18-24)12-8-10-20(3)6-2/h8-15,17-18H,5-7,16,19H2,1-4H3,(H,27,28)/b12-8-,20-10+ |
| InChIKey | QENNFVLUEJNEAY-PIBLRHIOSA-N |
| XLogP | 6.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|