C23H16N4O4S — CID 108749021
2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-5-carboxamide (PubChem CID 108749021) has the molecular formula C23H16N4O4S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-5-carboxamide.
| Compound Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108749021 |
| Molecular Formula | C23H16N4O4S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-5-carboxamide |
| SMILES | O=C(NCc1csc(-c2cccnc2)n1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C23H16N4O4S/c28-20(25-11-16-13-32-21(26-16)15-3-1-7-24-10-15)14-5-6-18-19(9-14)23(30)27(22(18)29)12-17-4-2-8-31-17/h1-10,13H,11-12H2,(H,25,28) |
| InChIKey | ZRDFGIADELCWOG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|