C24H18FNO6 — CID 2490940
[4-(4-fluorophenyl)-4-oxobutyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2490940) has the molecular formula C24H18FNO6 and a molecular weight of 435.41 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-4-oxobutyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2490940 |
| Molecular Formula | C24H18FNO6 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(CCCOC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H18FNO6/c25-17-8-5-15(6-9-17)21(27)4-2-12-32-24(30)16-7-10-19-20(13-16)23(29)26(22(19)28)14-18-3-1-11-31-18/h1,3,5-11,13H,2,4,12,14H2 |
| InChIKey | PWTZQKGYLJIPBQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|