C23H19NO6 — CID 7738804
2-(2-methylphenoxy)ethyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7738804) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-(2-methylphenoxy)ethyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(2-methylphenoxy)ethyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7738804 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-(2-methylphenoxy)ethyl 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccccc1OCCOC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C23H19NO6/c1-15-5-2-3-7-20(15)29-11-12-30-23(27)16-8-9-18-19(13-16)22(26)24(21(18)25)14-17-6-4-10-28-17/h2-10,13H,11-12,14H2,1H3 |
| InChIKey | DGHRLDJJDXYJNZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|