C22H14ClNO6 — CID 2491125
[2-(3-chlorophenyl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2491125) has the molecular formula C22H14ClNO6 and a molecular weight of 423.81 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(3-chlorophenyl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2491125 |
| Molecular Formula | C22H14ClNO6 |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [2-(3-chlorophenyl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H14ClNO6/c23-15-4-1-3-13(9-15)19(25)12-30-22(28)14-6-7-17-18(10-14)21(27)24(20(17)26)11-16-5-2-8-29-16/h1-10H,11-12H2 |
| InChIKey | ROQIFYMXANJLSK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|