C20H12ClNO6S — CID 2674496
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2674496) has the molecular formula C20H12ClNO6S and a molecular weight of 429.84 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2674496 |
| Molecular Formula | C20H12ClNO6S |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCC(=O)c1ccc(Cl)s1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C20H12ClNO6S/c21-17-6-5-16(29-17)15(23)10-28-20(26)11-3-4-13-14(8-11)19(25)22(18(13)24)9-12-2-1-7-27-12/h1-8H,9-10H2 |
| InChIKey | MQPWYXWXTJGWGC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|