C21H14N2O6 — CID 55828982
(3-carbamoylphenyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55828982) has the molecular formula C21H14N2O6 and a molecular weight of 390.35 g/mol. Its IUPAC name is (3-carbamoylphenyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-carbamoylphenyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55828982 |
| Molecular Formula | C21H14N2O6 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (3-carbamoylphenyl) 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | NC(=O)c1cccc(OC(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)c1 |
| InChI | InChI=1S/C21H14N2O6/c22-18(24)12-3-1-4-14(9-12)29-21(27)13-6-7-16-17(10-13)20(26)23(19(16)25)11-15-5-2-8-28-15/h1-10H,11H2,(H2,22,24) |
| InChIKey | WUMXLGPOAGENKB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|