C18H15N3O7 — CID 2490847
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2490847) has the molecular formula C18H15N3O7 and a molecular weight of 385.33 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2490847 |
| Molecular Formula | C18H15N3O7 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O)C(=O)NC(N)=O |
| InChI | InChI=1S/C18H15N3O7/c1-9(14(22)20-18(19)26)28-17(25)10-4-5-12-13(7-10)16(24)21(15(12)23)8-11-3-2-6-27-11/h2-7,9H,8H2,1H3,(H3,19,20,22,26)/t9-/m0/s1 |
| InChIKey | FOKSVMZSLGKLLK-VIFPVBQESA-N |
| XLogP | 0.82 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|