C25H21N3O7 — CID 24659813
[1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 24659813) has the molecular formula C25H21N3O7 and a molecular weight of 475.46 g/mol. Its IUPAC name is [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 24659813 |
| Molecular Formula | C25H21N3O7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(C)OC(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)cc1 |
| InChI | InChI=1S/C25H21N3O7/c1-14(22(30)27-18-8-6-17(7-9-18)26-15(2)29)35-25(33)16-5-10-20-21(12-16)24(32)28(23(20)31)13-19-4-3-11-34-19/h3-12,14H,13H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | RJDWIHSOIVXNAI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|