C31H23ClN2O6 — CID 4670584
[1-oxo-1-(4-phenoxyanilino)propan-2-yl] 2-[(4-chlorophenyl)methyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4670584) has the molecular formula C31H23ClN2O6 and a molecular weight of 554.99 g/mol. Its IUPAC name is [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 2-[(4-chlorophenyl)methyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 2-[(4-chlorophenyl)methyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4670584 |
| Molecular Formula | C31H23ClN2O6 |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 2-[(4-chlorophenyl)methyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1)C(=O)N(Cc1ccc(Cl)cc1)C2=O)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C31H23ClN2O6/c1-19(28(35)33-23-12-14-25(15-13-23)40-24-5-3-2-4-6-24)39-31(38)21-9-16-26-27(17-21)30(37)34(29(26)36)18-20-7-10-22(32)11-8-20/h2-17,19H,18H2,1H3,(H,33,35) |
| InChIKey | HABDPMSBWZZXEH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|