C25H18ClFN2O5 — CID 55422192
[1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55422192) has the molecular formula C25H18ClFN2O5 and a molecular weight of 480.88 g/mol. Its IUPAC name is [1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55422192 |
| Molecular Formula | C25H18ClFN2O5 |
| Molecular Weight | 480.88 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C25H18ClFN2O5/c1-14(22(30)28-21-10-8-17(26)12-20(21)27)34-25(33)16-7-9-18-19(11-16)24(32)29(23(18)31)13-15-5-3-2-4-6-15/h2-12,14H,13H2,1H3,(H,28,30) |
| InChIKey | YLCXGNRRUPUFAQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|