C27H24N2O7 — CID 55422215
[1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55422215) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55422215 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)cc1OC |
| InChI | InChI=1S/C27H24N2O7/c1-16(24(30)28-19-10-12-22(34-2)23(14-19)35-3)36-27(33)18-9-11-20-21(13-18)26(32)29(25(20)31)15-17-7-5-4-6-8-17/h4-14,16H,15H2,1-3H3,(H,28,30) |
| InChIKey | SCUAUCHVYGYJNR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|