C28H26N2O7 — CID 4051388
[1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4051388) has the molecular formula C28H26N2O7 and a molecular weight of 502.52 g/mol. Its IUPAC name is [1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4051388 |
| Molecular Formula | C28H26N2O7 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | [1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-[(4-methoxyphenyl)methyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOc1ccc(NC(=O)C(C)OC(=O)c2ccc3c(c2)C(=O)N(Cc2ccc(OC)cc2)C3=O)cc1 |
| InChI | InChI=1S/C28H26N2O7/c1-4-36-22-12-8-20(9-13-22)29-25(31)17(2)37-28(34)19-7-14-23-24(15-19)27(33)30(26(23)32)16-18-5-10-21(35-3)11-6-18/h5-15,17H,4,16H2,1-3H3,(H,29,31) |
| InChIKey | IWVWTRJFYCQHIQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|