C26H21ClN2O5 — CID 16507224
[1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16507224) has the molecular formula C26H21ClN2O5 and a molecular weight of 476.92 g/mol. Its IUPAC name is [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16507224 |
| Molecular Formula | C26H21ClN2O5 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | [1-(4-ethylanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCc1ccc(NC(=O)C(C)OC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2Cl)C3=O)cc1 |
| InChI | InChI=1S/C26H21ClN2O5/c1-3-16-8-11-18(12-9-16)28-23(30)15(2)34-26(33)17-10-13-19-20(14-17)25(32)29(24(19)31)22-7-5-4-6-21(22)27/h4-15H,3H2,1-2H3,(H,28,30) |
| InChIKey | XTKHCIOHZXEHDG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|