C25H22ClN3O5 — CID 42051645
[(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42051645) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42051645 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C25H22ClN3O5/c1-15(21(30)28-25(14-27)11-5-2-6-12-25)34-24(33)16-9-10-17-18(13-16)23(32)29(22(17)31)20-8-4-3-7-19(20)26/h3-4,7-10,13,15H,2,5-6,11-12H2,1H3,(H,28,30)/t15-/m0/s1 |
| InChIKey | KCDKFKVOKAJXCK-HNNXBMFYSA-N |
| XLogP | 4.03 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|