C26H20ClN3O6 — CID 16507222
[1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16507222) has the molecular formula C26H20ClN3O6 and a molecular weight of 505.91 g/mol. Its IUPAC name is [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16507222 |
| Molecular Formula | C26H20ClN3O6 |
| Molecular Weight | 505.91 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(C)OC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2Cl)C3=O)cc1 |
| InChI | InChI=1S/C26H20ClN3O6/c1-14(23(32)29-18-10-8-17(9-11-18)28-15(2)31)36-26(35)16-7-12-19-20(13-16)25(34)30(24(19)33)22-6-4-3-5-21(22)27/h3-14H,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | IJBWWNBMQGKBQJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|