C24H18ClN3O5 — CID 41071617
[(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 41071617) has the molecular formula C24H18ClN3O5 and a molecular weight of 463.88 g/mol. Its IUPAC name is [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 41071617 |
| Molecular Formula | C24H18ClN3O5 |
| Molecular Weight | 463.88 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)O[C@@H](C)C(=O)Nc3ccc(Cl)cn3)cc2C1=O |
| InChI | InChI=1S/C24H18ClN3O5/c1-13-5-3-4-6-19(13)28-22(30)17-9-7-15(11-18(17)23(28)31)24(32)33-14(2)21(29)27-20-10-8-16(25)12-26-20/h3-12,14H,1-2H3,(H,26,27,29)/t14-/m0/s1 |
| InChIKey | DFHMOMHBMZSDPB-AWEZNQCLSA-N |
| XLogP | 4.03 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|