C19H15Cl2NO4 — CID 1036799
1,3-dichloropropan-2-yl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1036799) has the molecular formula C19H15Cl2NO4 and a molecular weight of 392.24 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 1,3-dichloropropan-2-yl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1036799 |
| Molecular Formula | C19H15Cl2NO4 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 1,3-dichloropropan-2-yl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)OC(CCl)CCl)cc2C1=O |
| InChI | InChI=1S/C19H15Cl2NO4/c1-11-4-2-3-5-16(11)22-17(23)14-7-6-12(8-15(14)18(22)24)19(25)26-13(9-20)10-21/h2-8,13H,9-10H2,1H3 |
| InChIKey | LMWDVTWZICCTDR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|