C23H15Cl2NO4 — CID 18285008
(2,4-dichlorophenyl)methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 18285008) has the molecular formula C23H15Cl2NO4 and a molecular weight of 440.28 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2,4-dichlorophenyl)methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 18285008 |
| Molecular Formula | C23H15Cl2NO4 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)OCc3ccc(Cl)cc3Cl)cc2C1=O |
| InChI | InChI=1S/C23H15Cl2NO4/c1-13-4-2-3-5-20(13)26-21(27)17-9-7-14(10-18(17)22(26)28)23(29)30-12-15-6-8-16(24)11-19(15)25/h2-11H,12H2,1H3 |
| InChIKey | ZFLZQFBZMXPLKX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|