C22H13ClFNO4 — CID 7637726
(2-fluorophenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7637726) has the molecular formula C22H13ClFNO4 and a molecular weight of 409.80 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (2-fluorophenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7637726 |
| Molecular Formula | C22H13ClFNO4 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | (2-fluorophenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(OCc1ccccc1F)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O |
| InChI | InChI=1S/C22H13ClFNO4/c23-17-6-2-4-8-19(17)25-20(26)15-10-9-13(11-16(15)21(25)27)22(28)29-12-14-5-1-3-7-18(14)24/h1-11H,12H2 |
| InChIKey | OGINSBQIRNOUNZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|