C21H15ClN2O5 — CID 4242540
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4242540) has the molecular formula C21H15ClN2O5 and a molecular weight of 410.81 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4242540 |
| Molecular Formula | C21H15ClN2O5 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1noc(C)c1COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O |
| InChI | InChI=1S/C21H15ClN2O5/c1-11-16(12(2)29-23-11)10-28-21(27)13-7-8-14-15(9-13)20(26)24(19(14)25)18-6-4-3-5-17(18)22/h3-9H,10H2,1-2H3 |
| InChIKey | BAQKWDBRWPMYCR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|