C23H15BrClNO4 — CID 2067489
(4-bromophenyl)methyl 2-(3-chloro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2067489) has the molecular formula C23H15BrClNO4 and a molecular weight of 484.73 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-(3-chloro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (4-bromophenyl)methyl 2-(3-chloro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2067489 |
| Molecular Formula | C23H15BrClNO4 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | (4-bromophenyl)methyl 2-(3-chloro-2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1c(Cl)cccc1N1C(=O)c2ccc(C(=O)OCc3ccc(Br)cc3)cc2C1=O |
| InChI | InChI=1S/C23H15BrClNO4/c1-13-19(25)3-2-4-20(13)26-21(27)17-10-7-15(11-18(17)22(26)28)23(29)30-12-14-5-8-16(24)9-6-14/h2-11H,12H2,1H3 |
| InChIKey | IQQPUMAXFIHJEA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|