C23H16ClNO5 — CID 16577462
(4-methoxyphenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16577462) has the molecular formula C23H16ClNO5 and a molecular weight of 421.84 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16577462 |
| Molecular Formula | C23H16ClNO5 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(COC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2Cl)C3=O)cc1 |
| InChI | InChI=1S/C23H16ClNO5/c1-29-16-9-6-14(7-10-16)13-30-23(28)15-8-11-17-18(12-15)22(27)25(21(17)26)20-5-3-2-4-19(20)24/h2-12H,13H2,1H3 |
| InChIKey | KASQYGRKKRVBEC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|