C24H16Cl2N2O5 — CID 2437348
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2437348) has the molecular formula C24H16Cl2N2O5 and a molecular weight of 483.31 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2437348 |
| Molecular Formula | C24H16Cl2N2O5 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C24H16Cl2N2O5/c25-18-6-2-1-5-15(18)12-27-21(29)13-33-24(32)14-9-10-16-17(11-14)23(31)28(22(16)30)20-8-4-3-7-19(20)26/h1-11H,12-13H2,(H,27,29) |
| InChIKey | YODYVVHONSYUOL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|