C26H25ClN2O6 — CID 24593355
[2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 24593355) has the molecular formula C26H25ClN2O6 and a molecular weight of 496.95 g/mol. Its IUPAC name is [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 24593355 |
| Molecular Formula | C26H25ClN2O6 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 2-(2-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1C(=O)COC(=O)c1ccc2c(c1)C(=O)N(c1ccccc1Cl)C2=O |
| InChI | InChI=1S/C26H25ClN2O6/c1-25(2)12-16(30)13-26(3,4)29(25)21(31)14-35-24(34)15-9-10-17-18(11-15)23(33)28(22(17)32)20-8-6-5-7-19(20)27/h5-11H,12-14H2,1-4H3 |
| InChIKey | WAFMEGBQJPUEOK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|