C18H22INO4 — CID 24574821
[2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-iodobenzoate (PubChem CID 24574821) has the molecular formula C18H22INO4 and a molecular weight of 443.28 g/mol. Its IUPAC name is [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-iodobenzoate.
| Compound Name | [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 24574821 |
| Molecular Formula | C18H22INO4 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | [2-oxo-2-(2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)ethyl] 4-iodobenzoate |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1C(=O)COC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H22INO4/c1-17(2)9-14(21)10-18(3,4)20(17)15(22)11-24-16(23)12-5-7-13(19)8-6-12/h5-8H,9-11H2,1-4H3 |
| InChIKey | NDRGNGKHTPMFCH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|