About [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane
[2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane (PubChem CID 145271247) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane.
Molecular Properties
| Compound Name | [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane |
| PubChem CID | 145271247 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane |
| SMILES | CCCC.Cc1ccc(C(=O)OCC(=O)N2CCC2)cc1 |
| InChI | InChI=1S/C13H15NO3.C4H10/c1-10-3-5-11(6-4-10)13(16)17-9-12(15)14-7-2-8-14;1-3-4-2/h3-6H,2,7-9H2,1H3;3-4H2,1-2H3 |
| InChIKey | NYYQHQILDFPPMZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane?
The IUPAC name of [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane (CID 145271247) is [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane.
What is the SMILES notation for [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane?
The canonical SMILES for [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane is CCCC.Cc1ccc(C(=O)OCC(=O)N2CCC2)cc1.
What is the InChIKey of [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane?
The InChIKey is NYYQHQILDFPPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3.C4H10/c1-10-3-5-11(6-4-10)13(16)17-9-12(15)14-7-2-8-14;1-3-4-2/h3-6H,2,7-9H2,1H3;3-4H2,1-2H3.
What are the key properties of [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane?
[2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane has a molecular weight of 291.39 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(azetidin-1-yl)-2-oxoethyl] 4-methylbenzoate;butane is sourced from PubChem (CID 145271247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).