About (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane
(2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane (PubChem CID 145271189) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane.
Molecular Properties
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane |
| PubChem CID | 145271189 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane |
| SMILES | CCC.Cc1ccc(C(=O)OCC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C14H17NO3.C3H8/c1-11-4-6-12(7-5-11)14(17)18-10-13(16)15-8-2-3-9-15;1-3-2/h4-7H,2-3,8-10H2,1H3;3H2,1-2H3 |
| InChIKey | WEYIIXRSPBOTCA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane?
The IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane (CID 145271189) is (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane.
What is the SMILES notation for (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane?
The canonical SMILES for (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane is CCC.Cc1ccc(C(=O)OCC(=O)N2CCCC2)cc1.
What is the InChIKey of (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane?
The InChIKey is WEYIIXRSPBOTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3.C3H8/c1-11-4-6-12(7-5-11)14(17)18-10-13(16)15-8-2-3-9-15;1-3-2/h4-7H,2-3,8-10H2,1H3;3H2,1-2H3.
What are the key properties of (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane?
(2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane has a molecular weight of 291.39 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylbenzoate;propane is sourced from PubChem (CID 145271189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).